C22H27NO8 — CID 126636610
N-[2-[[(6Z,12E)-9,10,18-trihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]ethyl]acetamide (PubChem CID 126636610) has the molecular formula C22H27NO8 and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[2-[[(6Z,12E)-9,10,18-trihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]ethyl]acetamide.
| Compound Name | N-[2-[[(6Z,12E)-9,10,18-trihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 126636610 |
| Molecular Formula | C22H27NO8 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[2-[[(6Z,12E)-9,10,18-trihydroxy-4-methyl-2,8-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaen-16-yl]oxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOc1cc(O)c2c(c1)/C=C/CC(O)C(O)C(=O)/C=C\CC(C)OC2=O |
| InChI | InChI=1S/C22H27NO8/c1-13-5-3-7-17(25)21(28)18(26)8-4-6-15-11-16(30-10-9-23-14(2)24)12-19(27)20(15)22(29)31-13/h3-4,6-7,11-13,18,21,26-28H,5,8-10H2,1-2H3,(H,23,24)/b6-4+,7-3- |
| InChIKey | WURLMKAAXCKFJS-KUSYPTLRSA-N |
| XLogP | 1.11 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|