About N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide
N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide (PubChem CID 126636618) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide.
Molecular Properties
| Compound Name | N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide |
| PubChem CID | 126636618 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide |
| SMILES | C=C/C=C(/C)N/C(C)=N/C |
| InChI | InChI=1S/C8H14N2/c1-5-6-7(2)10-8(3)9-4/h5-6H,1H2,2-4H3,(H,9,10)/b7-6- |
| InChIKey | IIMXYRRLIWGBMA-SREVYHEPSA-N |
| XLogP | 1.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide?
The IUPAC name of N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide (CID 126636618) is N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide.
What is the SMILES notation for N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide?
The canonical SMILES for N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide is C=C/C=C(/C)N/C(C)=N/C.
What is the InChIKey of N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide?
The InChIKey is IIMXYRRLIWGBMA-SREVYHEPSA-N. The full InChI is InChI=1S/C8H14N2/c1-5-6-7(2)10-8(3)9-4/h5-6H,1H2,2-4H3,(H,9,10)/b7-6-.
What are the key properties of N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide?
N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide has a molecular weight of 138.21 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-[(2Z)-penta-2,4-dien-2-yl]ethanimidamide is sourced from PubChem (CID 126636618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).