C20H22F3NO6 — CID 126636627
(4S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4-methyl-16-(2,2,2-trifluoroethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 126636627) has the molecular formula C20H22F3NO6 and a molecular weight of 429.39 g/mol. Its IUPAC name is (4S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4-methyl-16-(2,2,2-trifluoroethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4-methyl-16-(2,2,2-trifluoroethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 126636627 |
| Molecular Formula | C20H22F3NO6 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (4S,6Z,9S,10S,12E)-9,10,18-trihydroxy-4-methyl-16-(2,2,2-trifluoroethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@H]1C/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(NCC(F)(F)F)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C20H22F3NO6/c1-11-4-2-6-14(25)18(28)15(26)7-3-5-12-8-13(24-10-20(21,22)23)9-16(27)17(12)19(29)30-11/h2-3,5-6,8-9,11,15,18,24,26-28H,4,7,10H2,1H3/b5-3+,6-2-/t11-,15-,18+/m0/s1 |
| InChIKey | AUNSBDRTUZNSNS-MLTOHSCHSA-N |
| XLogP | 2.57 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |