C23H23F3N2O4 — CID 126636677
N-[(1Z,3E)-1-(methylamino)-5-oxopenta-1,3-dien-3-yl]-2-(2-propan-2-yloxyphenoxy)-5-(trifluoromethyl)benzamide (PubChem CID 126636677) has the molecular formula C23H23F3N2O4 and a molecular weight of 448.44 g/mol. Its IUPAC name is N-[(1Z,3E)-1-(methylamino)-5-oxopenta-1,3-dien-3-yl]-2-(2-propan-2-yloxyphenoxy)-5-(trifluoromethyl)benzamide.
| Compound Name | N-[(1Z,3E)-1-(methylamino)-5-oxopenta-1,3-dien-3-yl]-2-(2-propan-2-yloxyphenoxy)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 126636677 |
| Molecular Formula | C23H23F3N2O4 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[(1Z,3E)-1-(methylamino)-5-oxopenta-1,3-dien-3-yl]-2-(2-propan-2-yloxyphenoxy)-5-(trifluoromethyl)benzamide |
| SMILES | CN/C=C\C(=C/C=O)NC(=O)c1cc(C(F)(F)F)ccc1Oc1ccccc1OC(C)C |
| InChI | InChI=1S/C23H23F3N2O4/c1-15(2)31-20-6-4-5-7-21(20)32-19-9-8-16(23(24,25)26)14-18(19)22(30)28-17(11-13-29)10-12-27-3/h4-15,27H,1-3H3,(H,28,30)/b12-10-,17-11+ |
| InChIKey | MRWHMGZORZBNNW-KCILXYFRSA-N |
| XLogP | 4.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|