C7H7F3 — CID 126636696
(3E)-2,3,6-trifluorohepta-1,3,6-triene (PubChem CID 126636696) has the molecular formula C7H7F3 and a molecular weight of 148.13 g/mol. Its IUPAC name is (3E)-2,3,6-trifluorohepta-1,3,6-triene.
| Compound Name | (3E)-2,3,6-trifluorohepta-1,3,6-triene |
|---|---|
| PubChem CID | 126636696 |
| Molecular Formula | C7H7F3 |
| Molecular Weight | 148.13 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | (3E)-2,3,6-trifluorohepta-1,3,6-triene |
| SMILES | C=C(F)C/C=C(/F)C(=C)F |
| InChI | InChI=1S/C7H7F3/c1-5(8)3-4-7(10)6(2)9/h4H,1-3H2/b7-4+ |
| InChIKey | KNFPRMDBRIYQRE-QPJJXVBHSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|