About (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine
(4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine (PubChem CID 126636706) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine.
Molecular Properties
| Compound Name | (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine |
| PubChem CID | 126636706 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine |
| SMILES | C/C=C(\C=C/C(CC)=N/C)C(C)C |
| InChI | InChI=1S/C12H21N/c1-6-11(10(3)4)8-9-12(7-2)13-5/h6,8-10H,7H2,1-5H3/b9-8-,11-6+,13-12+ |
| InChIKey | OALHYCDZPOSJLH-DZDRBRJISA-N |
| XLogP | 3.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine?
The IUPAC name of (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine (CID 126636706) is (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine.
What is the SMILES notation for (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine?
The canonical SMILES for (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine is C/C=C(\C=C/C(CC)=N/C)C(C)C.
What is the InChIKey of (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine?
The InChIKey is OALHYCDZPOSJLH-DZDRBRJISA-N. The full InChI is InChI=1S/C12H21N/c1-6-11(10(3)4)8-9-12(7-2)13-5/h6,8-10H,7H2,1-5H3/b9-8-,11-6+,13-12+.
What are the key properties of (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine?
(4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine has a molecular weight of 179.31 g/mol, XLogP of 3.63, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6Z)-N-methyl-6-propan-2-ylocta-4,6-dien-3-imine is sourced from PubChem (CID 126636706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).