C12H22O4 — CID 126636767
(Z,4R,5S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-ene-1,5-diol (PubChem CID 126636767) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (Z,4R,5S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-ene-1,5-diol.
| Compound Name | (Z,4R,5S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-ene-1,5-diol |
|---|---|
| PubChem CID | 126636767 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (Z,4R,5S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-ene-1,5-diol |
| SMILES | C[C@H](O)[C@H](C)/C=C\C(O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H22O4/c1-8(9(2)13)5-6-10(14)11-7-15-12(3,4)16-11/h5-6,8-11,13-14H,7H2,1-4H3/b6-5-/t8-,9+,10?,11+/m1/s1 |
| InChIKey | HKKGDXUWHROGKU-QGLJZTNDSA-N |
| XLogP | 1.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|