About (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate
(2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate (PubChem CID 126636947) has the molecular formula C8H14NO2S-
and a molecular weight of 188.27 g/mol. Its IUPAC name is (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate.
Molecular Properties
| Compound Name | (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate |
| PubChem CID | 126636947 |
| Molecular Formula | C8H14NO2S- |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate |
| SMILES | C/C=C(\C=C/CS(=O)[O-])CNC |
| InChI | InChI=1S/C8H15NO2S/c1-3-8(7-9-2)5-4-6-12(10)11/h3-5,9H,6-7H2,1-2H3,(H,10,11)/p-1/b5-4-,8-3+ |
| InChIKey | CRURAFFABZEQEH-UEQFWHKLSA-M |
| XLogP | 0.59 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate?
The IUPAC name of (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate (CID 126636947) is (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate.
What is the SMILES notation for (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate?
The canonical SMILES for (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate is C/C=C(\C=C/CS(=O)[O-])CNC.
What is the InChIKey of (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate?
The InChIKey is CRURAFFABZEQEH-UEQFWHKLSA-M. The full InChI is InChI=1S/C8H15NO2S/c1-3-8(7-9-2)5-4-6-12(10)11/h3-5,9H,6-7H2,1-2H3,(H,10,11)/p-1/b5-4-,8-3+.
What are the key properties of (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate?
(2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate has a molecular weight of 188.27 g/mol, XLogP of 0.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-4-(methylaminomethyl)hexa-2,4-diene-1-sulfinate is sourced from PubChem (CID 126636947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).