C18H30O3 — CID 126636966
(Z)-1-[(4R,5S)-5-[(E)-5,5-dimethyl-4-methylidenehex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-en-1-ol (PubChem CID 126636966) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (Z)-1-[(4R,5S)-5-[(E)-5,5-dimethyl-4-methylidenehex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-en-1-ol.
| Compound Name | (Z)-1-[(4R,5S)-5-[(E)-5,5-dimethyl-4-methylidenehex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 126636966 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (Z)-1-[(4R,5S)-5-[(E)-5,5-dimethyl-4-methylidenehex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-en-1-ol |
| SMILES | C=C(/C=C/C[C@@H]1OC(C)(C)O[C@@H]1C(O)/C=C\C)C(C)(C)C |
| InChI | InChI=1S/C18H30O3/c1-8-10-14(19)16-15(20-18(6,7)21-16)12-9-11-13(2)17(3,4)5/h8-11,14-16,19H,2,12H2,1,3-7H3/b10-8-,11-9+/t14?,15-,16+/m0/s1 |
| InChIKey | FCVOSDYNIFQSLL-CBHARCIWSA-N |
| XLogP | 3.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|