C14H25NO2S — CID 126636993
(2E,3Z)-2-ethylidene-5-ethylsulfonyl-N-methyl-N-propylhexa-3,5-dien-1-amine (PubChem CID 126636993) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-5-ethylsulfonyl-N-methyl-N-propylhexa-3,5-dien-1-amine.
| Compound Name | (2E,3Z)-2-ethylidene-5-ethylsulfonyl-N-methyl-N-propylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 126636993 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (2E,3Z)-2-ethylidene-5-ethylsulfonyl-N-methyl-N-propylhexa-3,5-dien-1-amine |
| SMILES | C=C(/C=C\C(=C/C)CN(C)CCC)S(=O)(=O)CC |
| InChI | InChI=1S/C14H25NO2S/c1-6-11-15(5)12-14(7-2)10-9-13(4)18(16,17)8-3/h7,9-10H,4,6,8,11-12H2,1-3,5H3/b10-9-,14-7+ |
| InChIKey | KWRWUEBPPZRSNQ-YNGKKNEWSA-N |
| XLogP | 2.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|