About (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine
(3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine (PubChem CID 126637047) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine.
Molecular Properties
| Compound Name | (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine |
| PubChem CID | 126637047 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine |
| SMILES | N/C=C/CNC1COC[C@@H](N)C1 |
| InChI | InChI=1S/C8H17N3O/c9-2-1-3-11-8-4-7(10)5-12-6-8/h1-2,7-8,11H,3-6,9-10H2/b2-1+/t7-,8?/m0/s1 |
| InChIKey | AEAGVDLYMNEQFG-KXFKZRRRSA-N |
| XLogP | -0.84 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine?
The IUPAC name of (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine (CID 126637047) is (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine.
What is the SMILES notation for (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine?
The canonical SMILES for (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine is N/C=C/CNC1COC[C@@H](N)C1.
What is the InChIKey of (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine?
The InChIKey is AEAGVDLYMNEQFG-KXFKZRRRSA-N. The full InChI is InChI=1S/C8H17N3O/c9-2-1-3-11-8-4-7(10)5-12-6-8/h1-2,7-8,11H,3-6,9-10H2/b2-1+/t7-,8?/m0/s1.
What are the key properties of (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine?
(3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine has a molecular weight of 171.24 g/mol, XLogP of -0.84, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-N-[(E)-3-aminoprop-2-enyl]oxane-3,5-diamine is sourced from PubChem (CID 126637047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).