About N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine
N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine (PubChem CID 126637190) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine.
Molecular Properties
| Compound Name | N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine |
| PubChem CID | 126637190 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine |
| SMILES | C=C/C=C(\C)C/N=C(\C)CC |
| InChI | InChI=1S/C10H17N/c1-5-7-9(3)8-11-10(4)6-2/h5,7H,1,6,8H2,2-4H3/b9-7+,11-10+ |
| InChIKey | YBOBJFDHPNYTFB-RJECPTDASA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine?
The IUPAC name of N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine (CID 126637190) is N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine.
What is the SMILES notation for N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine?
The canonical SMILES for N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine is C=C/C=C(\C)C/N=C(\C)CC.
What is the InChIKey of N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine?
The InChIKey is YBOBJFDHPNYTFB-RJECPTDASA-N. The full InChI is InChI=1S/C10H17N/c1-5-7-9(3)8-11-10(4)6-2/h5,7H,1,6,8H2,2-4H3/b9-7+,11-10+.
What are the key properties of N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine?
N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine has a molecular weight of 151.25 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-2-methylpenta-2,4-dienyl]butan-2-imine is sourced from PubChem (CID 126637190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).