About (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate
(5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate (PubChem CID 126637281) has the molecular formula C9H16NO2S-
and a molecular weight of 202.30 g/mol. Its IUPAC name is (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate.
Molecular Properties
| Compound Name | (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate |
| PubChem CID | 126637281 |
| Molecular Formula | C9H16NO2S- |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate |
| SMILES | C=CCC(/C=C\CCNC)S(=O)[O-] |
| InChI | InChI=1S/C9H17NO2S/c1-3-6-9(13(11)12)7-4-5-8-10-2/h3-4,7,9-10H,1,5-6,8H2,2H3,(H,11,12)/p-1/b7-4- |
| InChIKey | CJGVCUZJYNUZNX-DAXSKMNVSA-M |
| XLogP | 0.98 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate?
The IUPAC name of (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate (CID 126637281) is (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate.
What is the SMILES notation for (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate?
The canonical SMILES for (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate is C=CCC(/C=C\CCNC)S(=O)[O-].
What is the InChIKey of (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate?
The InChIKey is CJGVCUZJYNUZNX-DAXSKMNVSA-M. The full InChI is InChI=1S/C9H17NO2S/c1-3-6-9(13(11)12)7-4-5-8-10-2/h3-4,7,9-10H,1,5-6,8H2,2H3,(H,11,12)/p-1/b7-4-.
What are the key properties of (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate?
(5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate has a molecular weight of 202.30 g/mol, XLogP of 0.98, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-8-(methylamino)octa-1,5-diene-4-sulfinate is sourced from PubChem (CID 126637281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).