About (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol
(3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol (PubChem CID 126637364) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol.
Molecular Properties
| Compound Name | (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol |
| PubChem CID | 126637364 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol |
| SMILES | C=NC/C(C)=C/C(=C)S |
| InChI | InChI=1S/C7H11NS/c1-6(5-8-3)4-7(2)9/h4,9H,2-3,5H2,1H3/b6-4+ |
| InChIKey | RGAAEONHCBOHFX-GQCTYLIASA-N |
| XLogP | 2.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol?
The IUPAC name of (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol (CID 126637364) is (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol.
What is the SMILES notation for (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol?
The canonical SMILES for (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol is C=NC/C(C)=C/C(=C)S.
What is the InChIKey of (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol?
The InChIKey is RGAAEONHCBOHFX-GQCTYLIASA-N. The full InChI is InChI=1S/C7H11NS/c1-6(5-8-3)4-7(2)9/h4,9H,2-3,5H2,1H3/b6-4+.
What are the key properties of (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol?
(3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol has a molecular weight of 141.24 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-methyl-5-(methylideneamino)penta-1,3-diene-2-thiol is sourced from PubChem (CID 126637364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).