C22H31N — CID 126637939
(1E,12Z)-13-[(1E,4Z)-2-ethyl-3-methylidenehexa-1,4-dienyl]-12-methyl-9-azabicyclo[5.4.2]trideca-1(11),9,12-triene (PubChem CID 126637939) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is (1E,12Z)-13-[(1E,4Z)-2-ethyl-3-methylidenehexa-1,4-dienyl]-12-methyl-9-azabicyclo[5.4.2]trideca-1(11),9,12-triene.
| Compound Name | (1E,12Z)-13-[(1E,4Z)-2-ethyl-3-methylidenehexa-1,4-dienyl]-12-methyl-9-azabicyclo[5.4.2]trideca-1(11),9,12-triene |
|---|---|
| PubChem CID | 126637939 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | (1E,12Z)-13-[(1E,4Z)-2-ethyl-3-methylidenehexa-1,4-dienyl]-12-methyl-9-azabicyclo[5.4.2]trideca-1(11),9,12-triene |
| SMILES | C=C(/C=C\C)/C(=C/C1=C(C)/C2=C\C=N/CC1CCCCC2)CC |
| InChI | InChI=1S/C22H31N/c1-5-10-17(3)19(6-2)15-22-18(4)20-11-8-7-9-12-21(22)16-23-14-13-20/h5,10,13-15,21H,3,6-9,11-12,16H2,1-2,4H3/b10-5-,19-15+,20-13-,22-18-,23-14- |
| InChIKey | IMBUUNPWBDTKGX-QLMHLGCHSA-N |
| XLogP | 6.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|