C21H20N2O3 — CID 126638068
methyl 3-benzyl-7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carboxylate (PubChem CID 126638068) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 3-benzyl-7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carboxylate.
| Compound Name | methyl 3-benzyl-7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 126638068 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | methyl 3-benzyl-7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carboxylate |
| SMILES | COC(=O)c1cc2c(n1Cc1ccccc1)-c1ccncc1OC2(C)C |
| InChI | InChI=1S/C21H20N2O3/c1-21(2)16-11-17(20(24)25-3)23(13-14-7-5-4-6-8-14)19(16)15-9-10-22-12-18(15)26-21/h4-12H,13H2,1-3H3 |
| InChIKey | AEEUSHXLKUGKQV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |