C14H16N2O3 — CID 126638084
methyl 7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4-carboxylate (PubChem CID 126638084) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl 7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4-carboxylate.
| Compound Name | methyl 7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 126638084 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | methyl 7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2,10,12-tetraene-4-carboxylate |
| SMILES | COC(=O)C1CC2C(=N1)c1ccncc1OC2(C)C |
| InChI | InChI=1S/C14H16N2O3/c1-14(2)9-6-10(13(17)18-3)16-12(9)8-4-5-15-7-11(8)19-14/h4-5,7,9-10H,6H2,1-3H3 |
| InChIKey | LCHOOVNOWLAJPQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |