C23H30N4O4 — CID 126638129
tert-butyl 4-[(7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 126638129) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is tert-butyl 4-[(7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126638129 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl 4-[(7,7-dimethyl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2cc3c([nH]2)-c2ccncc2OC3(C)C)CC1 |
| InChI | InChI=1S/C23H30N4O4/c1-22(2,3)31-21(29)27-10-7-14(8-11-27)25-20(28)17-12-16-19(26-17)15-6-9-24-13-18(15)30-23(16,4)5/h6,9,12-14,26H,7-8,10-11H2,1-5H3,(H,25,28) |
| InChIKey | IRDGTEHCCLAMOY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |