About methyl 2-cyclopenta-1,3-dien-1-ylacetate
methyl 2-cyclopenta-1,3-dien-1-ylacetate (PubChem CID 12663826) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is methyl 2-cyclopenta-1,3-dien-1-ylacetate.
Molecular Properties
| Compound Name | methyl 2-cyclopenta-1,3-dien-1-ylacetate |
| PubChem CID | 12663826 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | methyl 2-cyclopenta-1,3-dien-1-ylacetate |
| SMILES | COC(=O)CC1=CC=CC1 |
| InChI | InChI=1S/C8H10O2/c1-10-8(9)6-7-4-2-3-5-7/h2-4H,5-6H2,1H3 |
| InChIKey | RGMJMESXAFWGDT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-cyclopenta-1,3-dien-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyclopenta-1,3-dien-1-ylacetate?
The IUPAC name of methyl 2-cyclopenta-1,3-dien-1-ylacetate (CID 12663826) is methyl 2-cyclopenta-1,3-dien-1-ylacetate.
What is the SMILES notation for methyl 2-cyclopenta-1,3-dien-1-ylacetate?
The canonical SMILES for methyl 2-cyclopenta-1,3-dien-1-ylacetate is COC(=O)CC1=CC=CC1.
What is the InChIKey of methyl 2-cyclopenta-1,3-dien-1-ylacetate?
The InChIKey is RGMJMESXAFWGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-10-8(9)6-7-4-2-3-5-7/h2-4H,5-6H2,1H3.
What are the key properties of methyl 2-cyclopenta-1,3-dien-1-ylacetate?
methyl 2-cyclopenta-1,3-dien-1-ylacetate has a molecular weight of 138.17 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyclopenta-1,3-dien-1-ylacetate is sourced from PubChem (CID 12663826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).