C17H20N4O2 — CID 126638329
3-ethylspiro[8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-7,4'-piperidine]-4-carboxamide (PubChem CID 126638329) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-ethylspiro[8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-7,4'-piperidine]-4-carboxamide.
| Compound Name | 3-ethylspiro[8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-7,4'-piperidine]-4-carboxamide |
|---|---|
| PubChem CID | 126638329 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-ethylspiro[8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-7,4'-piperidine]-4-carboxamide |
| SMILES | CCn1c(C(N)=O)cc2c1-c1ccncc1OC21CCNCC1 |
| InChI | InChI=1S/C17H20N4O2/c1-2-21-13(16(18)22)9-12-15(21)11-3-6-20-10-14(11)23-17(12)4-7-19-8-5-17/h3,6,9-10,19H,2,4-5,7-8H2,1H3,(H2,18,22) |
| InChIKey | LMVYGYMGJZTISD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |