C25H22Cl4N4O2 — CID 126638360
7-[2-[(3aS,4R,6S,6aR)-4-(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]ethyl]-2,3-dichloroquinoline (PubChem CID 126638360) has the molecular formula C25H22Cl4N4O2 and a molecular weight of 552.29 g/mol. Its IUPAC name is 7-[2-[(3aS,4R,6S,6aR)-4-(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]ethyl]-2,3-dichloroquinoline.
| Compound Name | 7-[2-[(3aS,4R,6S,6aR)-4-(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]ethyl]-2,3-dichloroquinoline |
|---|---|
| PubChem CID | 126638360 |
| Molecular Formula | C25H22Cl4N4O2 |
| Molecular Weight | 552.29 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 7-[2-[(3aS,4R,6S,6aR)-4-(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]ethyl]-2,3-dichloroquinoline |
| SMILES | CC1(C)O[C@@H]2[C@@H](CCc3ccc4cc(Cl)c(Cl)nc4c3)C[C@@H](n3ccc4c(Cl)nc(Cl)nc43)[C@@H]2O1 |
| InChI | InChI=1S/C25H22Cl4N4O2/c1-25(2)34-19-14(6-4-12-3-5-13-10-16(26)22(28)30-17(13)9-12)11-18(20(19)35-25)33-8-7-15-21(27)31-24(29)32-23(15)33/h3,5,7-10,14,18-20H,4,6,11H2,1-2H3/t14-,18+,19+,20-/m0/s1 |
| InChIKey | ZWYZVCLIGJYANE-PSAKCFHXSA-N |
| XLogP | 7.31 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.29 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|