C22H21N5O2 — CID 126638569
(1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(E)-2-quinolin-7-ylethenyl]cyclopentane-1,2-diol (PubChem CID 126638569) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(E)-2-quinolin-7-ylethenyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(E)-2-quinolin-7-ylethenyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 126638569 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(E)-2-quinolin-7-ylethenyl]cyclopentane-1,2-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1C[C@H](/C=C/c2ccc3cccnc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H21N5O2/c23-21-16-7-9-27(22(16)26-12-25-21)18-11-15(19(28)20(18)29)6-4-13-3-5-14-2-1-8-24-17(14)10-13/h1-10,12,15,18-20,28-29H,11H2,(H2,23,25,26)/b6-4+/t15-,18+,19+,20-/m0/s1 |
| InChIKey | XDAKIIHGALSVGF-DEPGCOPASA-N |
| XLogP | 2.56 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |