C54H48N6O3 — CID 126638671
1-N,3-N,5-N-tris[4-(6,7-dihydro-5H-cyclopenta[c]pyridin-3-yl)phenyl]-1-N,3-N,5-N-trimethylbenzene-1,3,5-tricarboxamide (PubChem CID 126638671) has the molecular formula C54H48N6O3 and a molecular weight of 829.02 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris[4-(6,7-dihydro-5H-cyclopenta[c]pyridin-3-yl)phenyl]-1-N,3-N,5-N-trimethylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris[4-(6,7-dihydro-5H-cyclopenta[c]pyridin-3-yl)phenyl]-1-N,3-N,5-N-trimethylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 126638671 |
| Molecular Formula | C54H48N6O3 |
| Molecular Weight | 829.02 g/mol |
| Exact Mass | 828.38 |
| IUPAC Name | 1-N,3-N,5-N-tris[4-(6,7-dihydro-5H-cyclopenta[c]pyridin-3-yl)phenyl]-1-N,3-N,5-N-trimethylbenzene-1,3,5-tricarboxamide |
| SMILES | CN(C(=O)c1cc(C(=O)N(C)c2ccc(-c3cc4c(cn3)CCC4)cc2)cc(C(=O)N(C)c2ccc(-c3cc4c(cn3)CCC4)cc2)c1)c1ccc(-c2cc3c(cn2)CCC3)cc1 |
| InChI | InChI=1S/C54H48N6O3/c1-58(46-19-13-34(14-20-46)49-28-37-7-4-10-40(37)31-55-49)52(61)43-25-44(53(62)59(2)47-21-15-35(16-22-47)50-29-38-8-5-11-41(38)32-56-50)27-45(26-43)54(63)60(3)48-23-17-36(18-24-48)51-30-39-9-6-12-42(39)33-57-51/h13-33H,4-12H2,1-3H3 |
| InChIKey | SFDDUTKLUGAXQK-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 99.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.02 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |