About tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate
tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate (PubChem CID 126638830) has the molecular formula C54H30F3N3O6
and a molecular weight of 873.84 g/mol. Its IUPAC name is tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate.
Molecular Properties
| Compound Name | tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate |
| PubChem CID | 126638830 |
| Molecular Formula | C54H30F3N3O6 |
| Molecular Weight | 873.84 g/mol |
| Exact Mass | 873.21 |
| IUPAC Name | tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate |
| SMILES | O=C(Oc1ccc(-c2ccc3cc(F)ccc3n2)cc1)c1cc(C(=O)Oc2ccc(-c3ccc4cc(F)ccc4n3)cc2)cc(C(=O)Oc2ccc(-c3ccc4cc(F)ccc4n3)cc2)c1 |
| InChI | InChI=1S/C54H30F3N3O6/c55-40-10-22-49-34(28-40)7-19-46(58-49)31-1-13-43(14-2-31)64-52(61)37-25-38(53(62)65-44-15-3-32(4-16-44)47-20-8-35-29-41(56)11-23-50(35)59-47)27-39(26-37)54(63)66-45-17-5-33(6-18-45)48-21-9-36-30-42(57)12-24-51(36)60-48/h1-30H |
| InChIKey | PTKFUADJRBSQPA-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 873.84 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate?
The IUPAC name of tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate (CID 126638830) is tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate.
What is the SMILES notation for tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate?
The canonical SMILES for tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate is O=C(Oc1ccc(-c2ccc3cc(F)ccc3n2)cc1)c1cc(C(=O)Oc2ccc(-c3ccc4cc(F)ccc4n3)cc2)cc(C(=O)Oc2ccc(-c3ccc4cc(F)ccc4n3)cc2)c1.
What is the InChIKey of tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate?
The InChIKey is PTKFUADJRBSQPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H30F3N3O6/c55-40-10-22-49-34(28-40)7-19-46(58-49)31-1-13-43(14-2-31)64-52(61)37-25-38(53(62)65-44-15-3-32(4-16-44)47-20-8-35-29-41(56)11-23-50(35)59-47)27-39(26-37)54(63)66-45-17-5-33(6-18-45)48-21-9-36-30-42(57)12-24-51(36)60-48/h1-30H.
What are the key properties of tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate?
tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate has a molecular weight of 873.84 g/mol, XLogP of 12.41, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tris[4-(6-fluoroquinolin-2-yl)phenyl] benzene-1,3,5-tricarboxylate is sourced from PubChem (CID 126638830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).