C27H30FN3O5 — CID 126638856
1-[2-[(2S,4R)-4-fluoro-2-(3-phenylpropylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]-3-(1-hydroxyethyl)indole-5-carboxylic acid (PubChem CID 126638856) has the molecular formula C27H30FN3O5 and a molecular weight of 495.55 g/mol. Its IUPAC name is 1-[2-[(2S,4R)-4-fluoro-2-(3-phenylpropylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]-3-(1-hydroxyethyl)indole-5-carboxylic acid.
| Compound Name | 1-[2-[(2S,4R)-4-fluoro-2-(3-phenylpropylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]-3-(1-hydroxyethyl)indole-5-carboxylic acid |
|---|---|
| PubChem CID | 126638856 |
| Molecular Formula | C27H30FN3O5 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 1-[2-[(2S,4R)-4-fluoro-2-(3-phenylpropylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]-3-(1-hydroxyethyl)indole-5-carboxylic acid |
| SMILES | CC(O)c1cn(CC(=O)N2C[C@H](F)C[C@H]2C(=O)NCCCc2ccccc2)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C27H30FN3O5/c1-17(32)22-15-30(23-10-9-19(27(35)36)12-21(22)23)16-25(33)31-14-20(28)13-24(31)26(34)29-11-5-8-18-6-3-2-4-7-18/h2-4,6-7,9-10,12,15,17,20,24,32H,5,8,11,13-14,16H2,1H3,(H,29,34)(H,35,36)/t17?,20-,24+/m1/s1 |
| InChIKey | GNNXENRZLSFKHT-MDTUAIDCSA-N |
| XLogP | 3.08 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|