C4H4F4O3 — CID 12663936
(3R,4S)-2,2,5,5-tetrafluorooxolane-3,4-diol (PubChem CID 12663936) has the molecular formula C4H4F4O3 and a molecular weight of 176.06 g/mol. Its IUPAC name is (3R,4S)-2,2,5,5-tetrafluorooxolane-3,4-diol.
| Compound Name | (3R,4S)-2,2,5,5-tetrafluorooxolane-3,4-diol |
|---|---|
| PubChem CID | 12663936 |
| Molecular Formula | C4H4F4O3 |
| Molecular Weight | 176.06 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | (3R,4S)-2,2,5,5-tetrafluorooxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)C(F)(F)OC1(F)F |
| InChI | InChI=1S/C4H4F4O3/c5-3(6)1(9)2(10)4(7,8)11-3/h1-2,9-10H/t1-,2+ |
| InChIKey | KSQYCVXAOJKYJB-XIXRPRMCSA-N |
| XLogP | -0.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.06 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |