C10H17N — CID 126639396
(2Z,4Z)-3,4,6-trimethylhepta-2,4,6-trien-2-amine (PubChem CID 126639396) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (2Z,4Z)-3,4,6-trimethylhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z)-3,4,6-trimethylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 126639396 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2Z,4Z)-3,4,6-trimethylhepta-2,4,6-trien-2-amine |
| SMILES | C=C(C)/C=C(C)\C(C)=C(\C)N |
| InChI | InChI=1S/C10H17N/c1-7(2)6-8(3)9(4)10(5)11/h6H,1,11H2,2-5H3/b8-6-,10-9- |
| InChIKey | CPHWGTQKQPKREU-VAOAJWRNSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|