C22H37N — CID 126639405
(3Z)-4-methyl-3-[(E,4R)-3-methyl-4-(4-methylidenecyclohexyl)pent-2-en-2-yl]octa-1,3-dien-2-amine (PubChem CID 126639405) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is (3Z)-4-methyl-3-[(E,4R)-3-methyl-4-(4-methylidenecyclohexyl)pent-2-en-2-yl]octa-1,3-dien-2-amine.
| Compound Name | (3Z)-4-methyl-3-[(E,4R)-3-methyl-4-(4-methylidenecyclohexyl)pent-2-en-2-yl]octa-1,3-dien-2-amine |
|---|---|
| PubChem CID | 126639405 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | (3Z)-4-methyl-3-[(E,4R)-3-methyl-4-(4-methylidenecyclohexyl)pent-2-en-2-yl]octa-1,3-dien-2-amine |
| SMILES | C=C1CCC([C@@H](C)/C(C)=C(C)/C(C(=C)N)=C(\C)CCCC)CC1 |
| InChI | InChI=1S/C22H37N/c1-8-9-10-16(3)22(20(7)23)19(6)17(4)18(5)21-13-11-15(2)12-14-21/h18,21H,2,7-14,23H2,1,3-6H3/b19-17+,22-16-/t18-/m0/s1 |
| InChIKey | OLAZDOGYZMFWLY-DGNZDJOISA-N |
| XLogP | 6.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|