About quinoline-7,8-diamine
quinoline-7,8-diamine (PubChem CID 12663943) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is quinoline-7,8-diamine.
Molecular Properties
| Compound Name | quinoline-7,8-diamine |
| PubChem CID | 12663943 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | quinoline-7,8-diamine |
| SMILES | Nc1ccc2cccnc2c1N |
| InChI | InChI=1S/C9H9N3/c10-7-4-3-6-2-1-5-12-9(6)8(7)11/h1-5H,10-11H2 |
| InChIKey | UUCNOUOCQLCWFP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze quinoline-7,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-7,8-diamine?
The IUPAC name of quinoline-7,8-diamine (CID 12663943) is quinoline-7,8-diamine.
What is the SMILES notation for quinoline-7,8-diamine?
The canonical SMILES for quinoline-7,8-diamine is Nc1ccc2cccnc2c1N.
What is the InChIKey of quinoline-7,8-diamine?
The InChIKey is UUCNOUOCQLCWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c10-7-4-3-6-2-1-5-12-9(6)8(7)11/h1-5H,10-11H2.
What are the key properties of quinoline-7,8-diamine?
quinoline-7,8-diamine has a molecular weight of 159.19 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-7,8-diamine is sourced from PubChem (CID 12663943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).