C17H25NO4 — CID 126639447
4-[[(3R,3aR,6R,6aR)-3-butoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-2-methylaniline (PubChem CID 126639447) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-[[(3R,3aR,6R,6aR)-3-butoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-2-methylaniline.
| Compound Name | 4-[[(3R,3aR,6R,6aR)-3-butoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-2-methylaniline |
|---|---|
| PubChem CID | 126639447 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-[[(3R,3aR,6R,6aR)-3-butoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-2-methylaniline |
| SMILES | CCCCO[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C17H25NO4/c1-3-4-7-19-14-9-20-17-15(10-21-16(14)17)22-12-5-6-13(18)11(2)8-12/h5-6,8,14-17H,3-4,7,9-10,18H2,1-2H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | NYIUZQJWYJMZPR-QBPKDAKJSA-N |
| XLogP | 2.31 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|