C21H36IN — CID 126639501
(3Z)-3-[(Z,4R)-3-iodo-4-(4-methylcyclohexyl)pent-2-en-2-yl]-4-methylocta-1,3-dien-2-amine (PubChem CID 126639501) has the molecular formula C21H36IN and a molecular weight of 429.43 g/mol. Its IUPAC name is (3Z)-3-[(Z,4R)-3-iodo-4-(4-methylcyclohexyl)pent-2-en-2-yl]-4-methylocta-1,3-dien-2-amine.
| Compound Name | (3Z)-3-[(Z,4R)-3-iodo-4-(4-methylcyclohexyl)pent-2-en-2-yl]-4-methylocta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 126639501 |
| Molecular Formula | C21H36IN |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (3Z)-3-[(Z,4R)-3-iodo-4-(4-methylcyclohexyl)pent-2-en-2-yl]-4-methylocta-1,3-dien-2-amine |
| SMILES | C=C(N)C(=C(/C)CCCC)/C(C)=C(\I)[C@H](C)C1CCC(C)CC1 |
| InChI | InChI=1S/C21H36IN/c1-7-8-9-15(3)20(18(6)23)17(5)21(22)16(4)19-12-10-14(2)11-13-19/h14,16,19H,6-13,23H2,1-5H3/b20-15-,21-17-/t14?,16-,19?/m1/s1 |
| InChIKey | GOLVDQJRYLZFFD-JLLZIYMLSA-N |
| XLogP | 7.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|