C16H27NO — CID 126639576
(3E,4E)-6-(azepan-4-yl)-3-ethylidene-4,5-dimethylhexa-1,4-dien-2-ol (PubChem CID 126639576) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (3E,4E)-6-(azepan-4-yl)-3-ethylidene-4,5-dimethylhexa-1,4-dien-2-ol.
| Compound Name | (3E,4E)-6-(azepan-4-yl)-3-ethylidene-4,5-dimethylhexa-1,4-dien-2-ol |
|---|---|
| PubChem CID | 126639576 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (3E,4E)-6-(azepan-4-yl)-3-ethylidene-4,5-dimethylhexa-1,4-dien-2-ol |
| SMILES | C=C(O)C(=C/C)/C(C)=C(\C)CC1CCCNCC1 |
| InChI | InChI=1S/C16H27NO/c1-5-16(14(4)18)13(3)12(2)11-15-7-6-9-17-10-8-15/h5,15,17-18H,4,6-11H2,1-3H3/b13-12+,16-5+ |
| InChIKey | DSEKVWIPEZHXMS-GUTDMRFLSA-N |
| XLogP | 4.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|