C20H34IN — CID 126639715
(3Z)-3-[(Z,4R)-3-iodo-4-(4-methylcyclohexyl)pent-2-en-2-yl]-4-methylhepta-1,3-dien-2-amine (PubChem CID 126639715) has the molecular formula C20H34IN and a molecular weight of 415.40 g/mol. Its IUPAC name is (3Z)-3-[(Z,4R)-3-iodo-4-(4-methylcyclohexyl)pent-2-en-2-yl]-4-methylhepta-1,3-dien-2-amine.
| Compound Name | (3Z)-3-[(Z,4R)-3-iodo-4-(4-methylcyclohexyl)pent-2-en-2-yl]-4-methylhepta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 126639715 |
| Molecular Formula | C20H34IN |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (3Z)-3-[(Z,4R)-3-iodo-4-(4-methylcyclohexyl)pent-2-en-2-yl]-4-methylhepta-1,3-dien-2-amine |
| SMILES | C=C(N)C(=C(/C)CCC)/C(C)=C(\I)[C@H](C)C1CCC(C)CC1 |
| InChI | InChI=1S/C20H34IN/c1-7-8-14(3)19(17(6)22)16(5)20(21)15(4)18-11-9-13(2)10-12-18/h13,15,18H,6-12,22H2,1-5H3/b19-14-,20-16-/t13?,15-,18?/m1/s1 |
| InChIKey | IQSIXSGMEZLKLP-SHMSQRFJSA-N |
| XLogP | 6.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|