C19H33N — CID 126639721
N-[(2R,3E,5Z)-4,6-dimethyl-2-(4-methylcyclohexyl)nona-3,5-dien-5-yl]methanimine (PubChem CID 126639721) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is N-[(2R,3E,5Z)-4,6-dimethyl-2-(4-methylcyclohexyl)nona-3,5-dien-5-yl]methanimine.
| Compound Name | N-[(2R,3E,5Z)-4,6-dimethyl-2-(4-methylcyclohexyl)nona-3,5-dien-5-yl]methanimine |
|---|---|
| PubChem CID | 126639721 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | N-[(2R,3E,5Z)-4,6-dimethyl-2-(4-methylcyclohexyl)nona-3,5-dien-5-yl]methanimine |
| SMILES | C=NC(=C(/C)CCC)/C(C)=C/[C@H](C)C1CCC(C)CC1 |
| InChI | InChI=1S/C19H33N/c1-7-8-15(3)19(20-6)17(5)13-16(4)18-11-9-14(2)10-12-18/h13-14,16,18H,6-12H2,1-5H3/b17-13+,19-15-/t14?,16-,18?/m0/s1 |
| InChIKey | ZZHDOQZZKOWMEW-RMMGJKONSA-N |
| XLogP | 6.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|