C20H35NS — CID 126639724
(2Z,4Z)-4-(1-aminoethenyl)-1-(4,4-dimethylcyclohexyl)-3,5-dimethylocta-2,4-diene-2-thiol (PubChem CID 126639724) has the molecular formula C20H35NS and a molecular weight of 321.57 g/mol. Its IUPAC name is (2Z,4Z)-4-(1-aminoethenyl)-1-(4,4-dimethylcyclohexyl)-3,5-dimethylocta-2,4-diene-2-thiol.
| Compound Name | (2Z,4Z)-4-(1-aminoethenyl)-1-(4,4-dimethylcyclohexyl)-3,5-dimethylocta-2,4-diene-2-thiol |
|---|---|
| PubChem CID | 126639724 |
| Molecular Formula | C20H35NS |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | (2Z,4Z)-4-(1-aminoethenyl)-1-(4,4-dimethylcyclohexyl)-3,5-dimethylocta-2,4-diene-2-thiol |
| SMILES | C=C(N)C(=C(/C)CCC)/C(C)=C(\S)CC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C20H35NS/c1-7-8-14(2)19(16(4)21)15(3)18(22)13-17-9-11-20(5,6)12-10-17/h17,22H,4,7-13,21H2,1-3,5-6H3/b18-15-,19-14- |
| InChIKey | MCVCGEVMFBFPQK-ZNPQHTLHSA-N |
| XLogP | 6.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|