C33H34N6O7S — CID 126639936
methyl 5-[[4-[4-[[(6aS)-2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methylimidazole-2-carbonyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 126639936) has the molecular formula C33H34N6O7S and a molecular weight of 658.74 g/mol. Its IUPAC name is methyl 5-[[4-[4-[[(6aS)-2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methylimidazole-2-carbonyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[[4-[4-[[(6aS)-2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methylimidazole-2-carbonyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 126639936 |
| Molecular Formula | C33H34N6O7S |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.22 |
| IUPAC Name | methyl 5-[[4-[4-[[(6aS)-2-methoxy-12-oxo-7,8,9,10-tetrahydro-6aH-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methylimidazole-2-carbonyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(NC(=O)c3nc(NC(=O)CCCOc4cc5c(cc4OC)C(=O)N4CCCC[C@H]4C=N5)cn3C)ccc2s1 |
| InChI | InChI=1S/C33H34N6O7S/c1-38-18-28(37-30(38)31(41)35-20-9-10-26-19(13-20)14-27(47-26)33(43)45-3)36-29(40)8-6-12-46-25-16-23-22(15-24(25)44-2)32(42)39-11-5-4-7-21(39)17-34-23/h9-10,13-18,21H,4-8,11-12H2,1-3H3,(H,35,41)(H,36,40)/t21-/m0/s1 |
| InChIKey | LFZVNIWNTFGCCF-NRFANRHFSA-N |
| XLogP | 5.19 |
| TPSA | 153.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|