About (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine
(Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine (PubChem CID 126640022) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine.
Molecular Properties
| Compound Name | (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine |
| PubChem CID | 126640022 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine |
| SMILES | C/N=C/C=C\C1=C(C)CC(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C18H31N/c1-13-12-15(17(2,3)4)16(18(5,6)7)14(13)10-9-11-19-8/h9-11,15-16H,12H2,1-8H3/b10-9-,19-11+ |
| InChIKey | VLZXQHXKUMFBJO-ITEIZMRHSA-N |
| XLogP | 5.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine?
The IUPAC name of (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine (CID 126640022) is (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine.
What is the SMILES notation for (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine?
The canonical SMILES for (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine is C/N=C/C=C\C1=C(C)CC(C(C)(C)C)C1C(C)(C)C.
What is the InChIKey of (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine?
The InChIKey is VLZXQHXKUMFBJO-ITEIZMRHSA-N. The full InChI is InChI=1S/C18H31N/c1-13-12-15(17(2,3)4)16(18(5,6)7)14(13)10-9-11-19-8/h9-11,15-16H,12H2,1-8H3/b10-9-,19-11+.
What are the key properties of (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine?
(Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine has a molecular weight of 261.45 g/mol, XLogP of 5.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(4,5-ditert-butyl-2-methylcyclopenten-1-yl)-N-methylprop-2-en-1-imine is sourced from PubChem (CID 126640022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).