C23H34N2O6 — CID 126640438
ethyl 6-[[(10S)-10-(hydroxymethyl)-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]hexanoate (PubChem CID 126640438) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is ethyl 6-[[(10S)-10-(hydroxymethyl)-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]hexanoate.
| Compound Name | ethyl 6-[[(10S)-10-(hydroxymethyl)-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]hexanoate |
|---|---|
| PubChem CID | 126640438 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | ethyl 6-[[(10S)-10-(hydroxymethyl)-2-methoxy-12-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[2,1-c][1,4]benzodiazepin-3-yl]oxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1cc2c(cc1OC)C(=O)N1C(CCC[C@H]1CO)CN2 |
| InChI | InChI=1S/C23H34N2O6/c1-3-30-22(27)10-5-4-6-11-31-21-13-19-18(12-20(21)29-2)23(28)25-16(14-24-19)8-7-9-17(25)15-26/h12-13,16-17,24,26H,3-11,14-15H2,1-2H3/t16?,17-/m0/s1 |
| InChIKey | LNBKDLQGQBVWGG-DJNXLDHESA-N |
| XLogP | 2.98 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|