About 4-cyclohexa-1,3-dien-1-ylmorpholine
4-cyclohexa-1,3-dien-1-ylmorpholine (PubChem CID 12664078) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-ylmorpholine.
Molecular Properties
| Compound Name | 4-cyclohexa-1,3-dien-1-ylmorpholine |
| PubChem CID | 12664078 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-ylmorpholine |
| SMILES | C1=CCCC(N2CCOCC2)=C1 |
| InChI | InChI=1S/C10H15NO/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-2,4H,3,5-9H2 |
| InChIKey | AYLQKQNLDNJJDJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexa-1,3-dien-1-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,3-dien-1-ylmorpholine?
The IUPAC name of 4-cyclohexa-1,3-dien-1-ylmorpholine (CID 12664078) is 4-cyclohexa-1,3-dien-1-ylmorpholine.
What is the SMILES notation for 4-cyclohexa-1,3-dien-1-ylmorpholine?
The canonical SMILES for 4-cyclohexa-1,3-dien-1-ylmorpholine is C1=CCCC(N2CCOCC2)=C1.
What is the InChIKey of 4-cyclohexa-1,3-dien-1-ylmorpholine?
The InChIKey is AYLQKQNLDNJJDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-2,4H,3,5-9H2.
What are the key properties of 4-cyclohexa-1,3-dien-1-ylmorpholine?
4-cyclohexa-1,3-dien-1-ylmorpholine has a molecular weight of 165.24 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,3-dien-1-ylmorpholine is sourced from PubChem (CID 12664078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).