About 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine
4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine (PubChem CID 12664080) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine.
Molecular Properties
| Compound Name | 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine |
| PubChem CID | 12664080 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine |
| SMILES | COC1=CCC=C(N2CCOCC2)C1 |
| InChI | InChI=1S/C11H17NO2/c1-13-11-4-2-3-10(9-11)12-5-7-14-8-6-12/h3-4H,2,5-9H2,1H3 |
| InChIKey | LZKUGEULLXAGQP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine?
The IUPAC name of 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine (CID 12664080) is 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine.
What is the SMILES notation for 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine?
The canonical SMILES for 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine is COC1=CCC=C(N2CCOCC2)C1.
What is the InChIKey of 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine?
The InChIKey is LZKUGEULLXAGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-13-11-4-2-3-10(9-11)12-5-7-14-8-6-12/h3-4H,2,5-9H2,1H3.
What are the key properties of 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine?
4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine has a molecular weight of 195.26 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methoxycyclohexa-1,4-dien-1-yl)morpholine is sourced from PubChem (CID 12664080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).