About 3-ethyl-3aH-indole
3-ethyl-3aH-indole (PubChem CID 126640835) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 3-ethyl-3aH-indole.
Molecular Properties
| Compound Name | 3-ethyl-3aH-indole |
| PubChem CID | 126640835 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-ethyl-3aH-indole |
| SMILES | CCC1=CN=C2C=CC=CC12 |
| InChI | InChI=1S/C10H11N/c1-2-8-7-11-10-6-4-3-5-9(8)10/h3-7,9H,2H2,1H3 |
| InChIKey | BFUKYRSIJDGKAY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-3aH-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3aH-indole?
The IUPAC name of 3-ethyl-3aH-indole (CID 126640835) is 3-ethyl-3aH-indole.
What is the SMILES notation for 3-ethyl-3aH-indole?
The canonical SMILES for 3-ethyl-3aH-indole is CCC1=CN=C2C=CC=CC12.
What is the InChIKey of 3-ethyl-3aH-indole?
The InChIKey is BFUKYRSIJDGKAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-2-8-7-11-10-6-4-3-5-9(8)10/h3-7,9H,2H2,1H3.
What are the key properties of 3-ethyl-3aH-indole?
3-ethyl-3aH-indole has a molecular weight of 145.20 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3aH-indole is sourced from PubChem (CID 126640835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).