About 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one
5-hydroxy-6,7-dinitro-2-phenylchromen-4-one (PubChem CID 126640967) has the molecular formula C15H8N2O7
and a molecular weight of 328.24 g/mol. Its IUPAC name is 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one |
| PubChem CID | 126640967 |
| Molecular Formula | C15H8N2O7 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc([N+](=O)[O-])c([N+](=O)[O-])c(O)c12 |
| InChI | InChI=1S/C15H8N2O7/c18-10-7-11(8-4-2-1-3-5-8)24-12-6-9(16(20)21)14(17(22)23)15(19)13(10)12/h1-7,19H |
| InChIKey | LTYQVFPGUWTTRP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one?
The IUPAC name of 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one (CID 126640967) is 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one.
What is the SMILES notation for 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one?
The canonical SMILES for 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one is O=c1cc(-c2ccccc2)oc2cc([N+](=O)[O-])c([N+](=O)[O-])c(O)c12.
What is the InChIKey of 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one?
The InChIKey is LTYQVFPGUWTTRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8N2O7/c18-10-7-11(8-4-2-1-3-5-8)24-12-6-9(16(20)21)14(17(22)23)15(19)13(10)12/h1-7,19H.
What are the key properties of 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one?
5-hydroxy-6,7-dinitro-2-phenylchromen-4-one has a molecular weight of 328.24 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-6,7-dinitro-2-phenylchromen-4-one is sourced from PubChem (CID 126640967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).