About (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane
(6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane (PubChem CID 126641157) has the molecular formula C13H21IO
and a molecular weight of 320.21 g/mol. Its IUPAC name is (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane.
Molecular Properties
| Compound Name | (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane |
| PubChem CID | 126641157 |
| Molecular Formula | C13H21IO |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane |
| SMILES | CC(I)OC12CC3CC[C@H](CC(C3)C1)C2 |
| InChI | InChI=1S/C13H21IO/c1-9(14)15-13-6-10-2-3-11(7-13)5-12(4-10)8-13/h9-12H,2-8H2,1H3/t9?,10-,11?,12?,13?/m1/s1 |
| InChIKey | NRRNDYNZHPUOGT-TZESXAPASA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane?
The IUPAC name of (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane (CID 126641157) is (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane.
What is the SMILES notation for (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane?
The canonical SMILES for (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane is CC(I)OC12CC3CC[C@H](CC(C3)C1)C2.
What is the InChIKey of (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane?
The InChIKey is NRRNDYNZHPUOGT-TZESXAPASA-N. The full InChI is InChI=1S/C13H21IO/c1-9(14)15-13-6-10-2-3-11(7-13)5-12(4-10)8-13/h9-12H,2-8H2,1H3/t9?,10-,11?,12?,13?/m1/s1.
What are the key properties of (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane?
(6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane has a molecular weight of 320.21 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-1-(1-iodoethoxy)tricyclo[4.3.1.13,8]undecane is sourced from PubChem (CID 126641157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).