C14H18N2O5 — CID 126641212
(2,5-dioxopyrrolidin-1-yl) 6-(5-oxo-2H-pyrrol-1-yl)hexanoate (PubChem CID 126641212) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-(5-oxo-2H-pyrrol-1-yl)hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-(5-oxo-2H-pyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 126641212 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(5-oxo-2H-pyrrol-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1CC=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H18N2O5/c17-11-5-4-10-15(11)9-3-1-2-6-14(20)21-16-12(18)7-8-13(16)19/h4-5H,1-3,6-10H2 |
| InChIKey | ZNZGPJYZJATUDD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|