C24H26N3O6P — CID 126641404
[3-acetyl-1-[2-[(2S)-2-(benzylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]indol-5-yl]phosphonic acid (PubChem CID 126641404) has the molecular formula C24H26N3O6P and a molecular weight of 483.46 g/mol. Its IUPAC name is [3-acetyl-1-[2-[(2S)-2-(benzylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]indol-5-yl]phosphonic acid.
| Compound Name | [3-acetyl-1-[2-[(2S)-2-(benzylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]indol-5-yl]phosphonic acid |
|---|---|
| PubChem CID | 126641404 |
| Molecular Formula | C24H26N3O6P |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [3-acetyl-1-[2-[(2S)-2-(benzylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]indol-5-yl]phosphonic acid |
| SMILES | CC(=O)c1cn(CC(=O)N2CCC[C@H]2C(=O)NCc2ccccc2)c2ccc(P(=O)(O)O)cc12 |
| InChI | InChI=1S/C24H26N3O6P/c1-16(28)20-14-26(21-10-9-18(12-19(20)21)34(31,32)33)15-23(29)27-11-5-8-22(27)24(30)25-13-17-6-3-2-4-7-17/h2-4,6-7,9-10,12,14,22H,5,8,11,13,15H2,1H3,(H,25,30)(H2,31,32,33)/t22-/m0/s1 |
| InChIKey | GLVYQHPBBONIQA-QFIPXVFZSA-N |
| XLogP | 1.95 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|