C41H49NO2 — CID 126641408
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-(dibenzylamino)-5-(4-phenylphenyl)pentanoate (PubChem CID 126641408) has the molecular formula C41H49NO2 and a molecular weight of 587.85 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-(dibenzylamino)-5-(4-phenylphenyl)pentanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-(dibenzylamino)-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 126641408 |
| Molecular Formula | C41H49NO2 |
| Molecular Weight | 587.85 g/mol |
| Exact Mass | 587.38 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-(dibenzylamino)-5-(4-phenylphenyl)pentanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)CCC(Cc1ccc(-c2ccccc2)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C41H49NO2/c1-31(2)39-25-19-32(3)27-40(39)44-41(43)26-24-38(28-33-20-22-37(23-21-33)36-17-11-6-12-18-36)42(29-34-13-7-4-8-14-34)30-35-15-9-5-10-16-35/h4-18,20-23,31-32,38-40H,19,24-30H2,1-3H3/t32-,38?,39+,40-/m1/s1 |
| InChIKey | QHNUYOKPLDURMQ-VFHGDWTRSA-N |
| XLogP | 9.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.85 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |