C38H44N2O — CID 126641412
(2S)-4-(dibenzylamino)-5-(4-phenylphenyl)-2-propan-2-yl-1-pyrrolidin-1-ylpentan-1-one (PubChem CID 126641412) has the molecular formula C38H44N2O and a molecular weight of 544.78 g/mol. Its IUPAC name is (2S)-4-(dibenzylamino)-5-(4-phenylphenyl)-2-propan-2-yl-1-pyrrolidin-1-ylpentan-1-one.
| Compound Name | (2S)-4-(dibenzylamino)-5-(4-phenylphenyl)-2-propan-2-yl-1-pyrrolidin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 126641412 |
| Molecular Formula | C38H44N2O |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | (2S)-4-(dibenzylamino)-5-(4-phenylphenyl)-2-propan-2-yl-1-pyrrolidin-1-ylpentan-1-one |
| SMILES | CC(C)[C@H](CC(Cc1ccc(-c2ccccc2)cc1)N(Cc1ccccc1)Cc1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C38H44N2O/c1-30(2)37(38(41)39-24-12-13-25-39)27-36(26-31-20-22-35(23-21-31)34-18-10-5-11-19-34)40(28-32-14-6-3-7-15-32)29-33-16-8-4-9-17-33/h3-11,14-23,30,36-37H,12-13,24-29H2,1-2H3/t36?,37-/m0/s1 |
| InChIKey | KKRLENODCYUXOJ-RWXFGYRSSA-N |
| XLogP | 8.25 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |