About butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate
butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate (PubChem CID 126641498) has the molecular formula C20H16F3NO7S
and a molecular weight of 471.41 g/mol. Its IUPAC name is butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate.
Molecular Properties
| Compound Name | butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate |
| PubChem CID | 126641498 |
| Molecular Formula | C20H16F3NO7S |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C20H16F3NO7S/c1-2-3-11-30-16(25)10-8-12-7-9-15-17-13(12)5-4-6-14(17)18(26)24(19(15)27)31-32(28,29)20(21,22)23/h4-10H,2-3,11H2,1H3/b10-8+ |
| InChIKey | BLLMEAOCTTZYGJ-CSKARUKUSA-N |
| XLogP | 3.57 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate?
The IUPAC name of butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate (CID 126641498) is butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate.
What is the SMILES notation for butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate?
The canonical SMILES for butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate is CCCCOC(=O)/C=C/c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C(F)(F)F)C2=O.
What is the InChIKey of butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate?
The InChIKey is BLLMEAOCTTZYGJ-CSKARUKUSA-N. The full InChI is InChI=1S/C20H16F3NO7S/c1-2-3-11-30-16(25)10-8-12-7-9-15-17-13(12)5-4-6-14(17)18(26)24(19(15)27)31-32(28,29)20(21,22)23/h4-10H,2-3,11H2,1H3/b10-8+.
What are the key properties of butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate?
butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate has a molecular weight of 471.41 g/mol, XLogP of 3.57, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (E)-3-[1,3-dioxo-2-(trifluoromethylsulfonyloxy)benzo[de]isoquinolin-6-yl]prop-2-enoate is sourced from PubChem (CID 126641498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).