C18H24FNO5 — CID 126641542
1-O-benzyl 2-O-butyl (2S,3S,4S)-4-fluoro-3-methoxypyrrolidine-1,2-dicarboxylate (PubChem CID 126641542) has the molecular formula C18H24FNO5 and a molecular weight of 353.39 g/mol. Its IUPAC name is 1-O-benzyl 2-O-butyl (2S,3S,4S)-4-fluoro-3-methoxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-butyl (2S,3S,4S)-4-fluoro-3-methoxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 126641542 |
| Molecular Formula | C18H24FNO5 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-O-benzyl 2-O-butyl (2S,3S,4S)-4-fluoro-3-methoxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)[C@@H]1[C@H](OC)[C@@H](F)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H24FNO5/c1-3-4-10-24-17(21)15-16(23-2)14(19)11-20(15)18(22)25-12-13-8-6-5-7-9-13/h5-9,14-16H,3-4,10-12H2,1-2H3/t14-,15-,16+/m0/s1 |
| InChIKey | HKUXUTRRZIJNEZ-HRCADAONSA-N |
| XLogP | 2.70 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|