(Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride

C7H10FN — CID 126641624

IUPAC(Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride
SMILESC=C(C)/N=C(F)/C=C\C
InChIInChI=1S/C7H10FN/c1-4-5-7(8)9-6(2)3/h4-5H,2H2,1,3H3/b5-4-,9-7-
InChIKeyNLTCMKCQGTXIMO-PHSHQRSZSA-N
MW127.16 g/mol
LogP2.46
Rot. Bonds2

About (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride

(Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride (PubChem CID 126641624) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride.

Molecular Properties

Compound Name(Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride
PubChem CID126641624
Molecular FormulaC7H10FN
Molecular Weight127.16 g/mol
Exact Mass127.08
IUPAC Name(Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride
SMILESC=C(C)/N=C(F)/C=C\C
InChIInChI=1S/C7H10FN/c1-4-5-7(8)9-6(2)3/h4-5H,2H2,1,3H3/b5-4-,9-7-
InChIKeyNLTCMKCQGTXIMO-PHSHQRSZSA-N
XLogP2.46
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.16
LogP ≤ 52.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride?
The IUPAC name of (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride (CID 126641624) is (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride.
What is the SMILES notation for (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride?
The canonical SMILES for (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride is C=C(C)/N=C(F)/C=C\C.
What is the InChIKey of (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride?
The InChIKey is NLTCMKCQGTXIMO-PHSHQRSZSA-N. The full InChI is InChI=1S/C7H10FN/c1-4-5-7(8)9-6(2)3/h4-5H,2H2,1,3H3/b5-4-,9-7-.
What are the key properties of (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride?
(Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride has a molecular weight of 127.16 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-prop-1-en-2-ylbut-2-enimidoyl fluoride is sourced from PubChem (CID 126641624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).